C20H25NO3 — CID 167687017
6-[[4-(2-methylpropoxy)-3-propan-2-ylphenyl]methyl]pyridine-3-carboxylic acid (PubChem CID 167687017) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 6-[[4-(2-methylpropoxy)-3-propan-2-ylphenyl]methyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[[4-(2-methylpropoxy)-3-propan-2-ylphenyl]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167687017 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 6-[[4-(2-methylpropoxy)-3-propan-2-ylphenyl]methyl]pyridine-3-carboxylic acid |
| SMILES | CC(C)COc1ccc(Cc2ccc(C(=O)O)cn2)cc1C(C)C |
| InChI | InChI=1S/C20H25NO3/c1-13(2)12-24-19-8-5-15(10-18(19)14(3)4)9-17-7-6-16(11-21-17)20(22)23/h5-8,10-11,13-14H,9,12H2,1-4H3,(H,22,23) |
| InChIKey | BASWXMDPYKTKOY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |