C19H17F4N4O2+ — CID 167687613
N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide (PubChem CID 167687613) has the molecular formula C19H17F4N4O2+ and a molecular weight of 409.36 g/mol. Its IUPAC name is N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide.
| Compound Name | N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 167687613 |
| Molecular Formula | C19H17F4N4O2+ |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
| SMILES | CCn1c[n+](NC(=O)c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)cc2)cn1 |
| InChI | InChI=1S/C19H16F4N4O2/c1-2-26-12-27(11-24-26)25-17(28)15-5-3-13(4-6-15)14-7-9-16(10-8-14)29-19(22,23)18(20)21/h3-12,18H,2H2,1H3/p+1 |
| InChIKey | WLHYXHNISLOSNI-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|