About 2-morpholin-4-yl-1,3-benzoxazol-5-amine
2-morpholin-4-yl-1,3-benzoxazol-5-amine (PubChem CID 16768943) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-morpholin-4-yl-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-1,3-benzoxazol-5-amine |
| PubChem CID | 16768943 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-morpholin-4-yl-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(N3CCOCC3)nc2c1 |
| InChI | InChI=1S/C11H13N3O2/c12-8-1-2-10-9(7-8)13-11(16-10)14-3-5-15-6-4-14/h1-2,7H,3-6,12H2 |
| InChIKey | QOLUHUNFWRRDQW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-yl-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-1,3-benzoxazol-5-amine?
The IUPAC name of 2-morpholin-4-yl-1,3-benzoxazol-5-amine (CID 16768943) is 2-morpholin-4-yl-1,3-benzoxazol-5-amine.
What is the SMILES notation for 2-morpholin-4-yl-1,3-benzoxazol-5-amine?
The canonical SMILES for 2-morpholin-4-yl-1,3-benzoxazol-5-amine is Nc1ccc2oc(N3CCOCC3)nc2c1.
What is the InChIKey of 2-morpholin-4-yl-1,3-benzoxazol-5-amine?
The InChIKey is QOLUHUNFWRRDQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c12-8-1-2-10-9(7-8)13-11(16-10)14-3-5-15-6-4-14/h1-2,7H,3-6,12H2.
What are the key properties of 2-morpholin-4-yl-1,3-benzoxazol-5-amine?
2-morpholin-4-yl-1,3-benzoxazol-5-amine has a molecular weight of 219.24 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-1,3-benzoxazol-5-amine is sourced from PubChem (CID 16768943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).