C30H20Cl2FN5O3 — CID 167691388
(1aS,2S,7bR)-6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2-[5-fluoro-4-(3-oxo-1,4-dihydroisochromen-7-yl)-3H-pyrrol-2-yl]-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-4-one (PubChem CID 167691388) has the molecular formula C30H20Cl2FN5O3 and a molecular weight of 588.43 g/mol. Its IUPAC name is (1aS,2S,7bR)-6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2-[5-fluoro-4-(3-oxo-1,4-dihydroisochromen-7-yl)-3H-pyrrol-2-yl]-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-4-one.
| Compound Name | (1aS,2S,7bR)-6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2-[5-fluoro-4-(3-oxo-1,4-dihydroisochromen-7-yl)-3H-pyrrol-2-yl]-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-4-one |
|---|---|
| PubChem CID | 167691388 |
| Molecular Formula | C30H20Cl2FN5O3 |
| Molecular Weight | 588.43 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | (1aS,2S,7bR)-6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2-[5-fluoro-4-(3-oxo-1,4-dihydroisochromen-7-yl)-3H-pyrrol-2-yl]-1,1a,2,7b-tetrahydrocyclopropa[a]indolizin-4-one |
| SMILES | O=C1Cc2ccc(C3=C(F)N=C([C@@H]4[C@H]5C[C@H]5c5cc(-c6cc(Cl)ccc6-n6cc(Cl)nn6)cc(=O)n54)C3)cc2CO1 |
| InChI | InChI=1S/C30H20Cl2FN5O3/c31-18-3-4-24(37-12-26(32)35-36-37)19(9-18)16-6-25-21-10-22(21)29(38(25)27(39)7-16)23-11-20(30(33)34-23)15-2-1-14-8-28(40)41-13-17(14)5-15/h1-7,9,12,21-22,29H,8,10-11,13H2/t21-,22+,29+/m1/s1 |
| InChIKey | WZRZNTRFHDGWGR-BXOOBUKZSA-N |
| XLogP | 5.84 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.43 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|