About N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide (PubChem CID 16769173) has the molecular formula C7H10N2O4S
and a molecular weight of 218.23 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide.
Molecular Properties
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide |
| PubChem CID | 16769173 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C7H10N2O4S/c10-3-5(11)8-1-2-9-6(12)4-14-7(9)13/h10H,1-4H2,(H,8,11) |
| InChIKey | POANJAMIHCLVLT-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide?
The IUPAC name of N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide (CID 16769173) is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide.
What is the SMILES notation for N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide?
The canonical SMILES for N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide is O=C(CO)NCCN1C(=O)CSC1=O.
What is the InChIKey of N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide?
The InChIKey is POANJAMIHCLVLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4S/c10-3-5(11)8-1-2-9-6(12)4-14-7(9)13/h10H,1-4H2,(H,8,11).
What are the key properties of N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide?
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide has a molecular weight of 218.23 g/mol, XLogP of -1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-hydroxyacetamide is sourced from PubChem (CID 16769173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).