About (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole
(2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole (PubChem CID 167692373) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole |
| PubChem CID | 167692373 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole |
| SMILES | CCCCC[C@@H]1NC(OC)C=C1OC |
| InChI | InChI=1S/C11H21NO2/c1-4-5-6-7-9-10(13-2)8-11(12-9)14-3/h8-9,11-12H,4-7H2,1-3H3/t9-,11?/m0/s1 |
| InChIKey | QMWBRXURTBKFOH-FTNKSUMCSA-N |
| XLogP | 2.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole?
The IUPAC name of (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole (CID 167692373) is (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole.
What is the SMILES notation for (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole?
The canonical SMILES for (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole is CCCCC[C@@H]1NC(OC)C=C1OC.
What is the InChIKey of (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole?
The InChIKey is QMWBRXURTBKFOH-FTNKSUMCSA-N. The full InChI is InChI=1S/C11H21NO2/c1-4-5-6-7-9-10(13-2)8-11(12-9)14-3/h8-9,11-12H,4-7H2,1-3H3/t9-,11?/m0/s1.
What are the key properties of (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole?
(2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole has a molecular weight of 199.29 g/mol, XLogP of 2.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,5-dimethoxy-2-pentyl-2,5-dihydro-1H-pyrrole is sourced from PubChem (CID 167692373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).