C45H45F3GeN2O4 — CID 167692923
[diethyl-[1',3',3'-trimethyl-5'-(trifluoromethyl)spiro[chromene-2,2'-indole]-6-carbonyl]germyl]-(3,3,5-trimethylspiro[1H-indole-2,2'-chromene]-6'-yl)methanone (PubChem CID 167692923) has the molecular formula C45H45F3GeN2O4 and a molecular weight of 807.47 g/mol. Its IUPAC name is [diethyl-[1',3',3'-trimethyl-5'-(trifluoromethyl)spiro[chromene-2,2'-indole]-6-carbonyl]germyl]-(3,3,5-trimethylspiro[1H-indole-2,2'-chromene]-6'-yl)methanone.
| Compound Name | [diethyl-[1',3',3'-trimethyl-5'-(trifluoromethyl)spiro[chromene-2,2'-indole]-6-carbonyl]germyl]-(3,3,5-trimethylspiro[1H-indole-2,2'-chromene]-6'-yl)methanone |
|---|---|
| PubChem CID | 167692923 |
| Molecular Formula | C45H45F3GeN2O4 |
| Molecular Weight | 807.47 g/mol |
| Exact Mass | 808.25 |
| IUPAC Name | [diethyl-[1',3',3'-trimethyl-5'-(trifluoromethyl)spiro[chromene-2,2'-indole]-6-carbonyl]germyl]-(3,3,5-trimethylspiro[1H-indole-2,2'-chromene]-6'-yl)methanone |
| SMILES | CC[Ge](CC)(C(=O)c1ccc2c(c1)C=CC1(Nc3ccc(C)cc3C1(C)C)O2)C(=O)c1ccc2c(c1)C=CC1(O2)N(C)c2ccc(C(F)(F)F)cc2C1(C)C |
| InChI | InChI=1S/C45H45F3GeN2O4/c1-9-49(10-2,39(52)30-12-17-37-28(24-30)19-21-43(54-37)41(4,5)33-23-27(3)11-15-35(33)50-43)40(53)31-13-18-38-29(25-31)20-22-44(55-38)42(6,7)34-26-32(45(46,47)48)14-16-36(34)51(44)8/h11-26,50H,9-10H2,1-8H3 |
| InChIKey | UCLQHXKSLGXHQE-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.47 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |