C5H9O3- — CID 167693374
(3S,4R,5S)-5-hydroxy-4-methyl(2,3,4,5-13C4)oxolan-3-olate (PubChem CID 167693374) has the molecular formula C5H9O3- and a molecular weight of 121.09 g/mol. Its IUPAC name is (3S,4R,5S)-5-hydroxy-4-methyl(2,3,4,5-13C4)oxolan-3-olate.
| Compound Name | (3S,4R,5S)-5-hydroxy-4-methyl(2,3,4,5-13C4)oxolan-3-olate |
|---|---|
| PubChem CID | 167693374 |
| Molecular Formula | C5H9O3- |
| Molecular Weight | 121.09 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | (3S,4R,5S)-5-hydroxy-4-methyl(2,3,4,5-13C4)oxolan-3-olate |
| SMILES | C[13C@@H]1[13C@H]([O-])[13CH2]O[13C@@H]1O |
| InChI | InChI=1S/C5H9O3/c1-3-4(6)2-8-5(3)7/h3-5,7H,2H2,1H3/q-1/t3-,4-,5+/m1/s1/i2+1,3+1,4+1,5+1 |
| InChIKey | XGZADBPZTALDPR-COIHPGCUSA-N |
| XLogP | -1.30 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.09 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |