N,N-bis(3-methylbutyl)sulfamoyl chloride

C10H22ClNO2S — CID 16769428

IUPACN,N-bis(3-methylbutyl)sulfamoyl chloride
SMILESCC(C)CCN(CCC(C)C)S(=O)(=O)Cl
InChIInChI=1S/C10H22ClNO2S/c1-9(2)5-7-12(15(11,13)14)8-6-10(3)4/h9-10H,5-8H2,1-4H3
InChIKeyDAPGCOVJHZPQCB-UHFFFAOYSA-N
MW255.81 g/mol
LogP2.86
Rot. Bonds7

About N,N-bis(3-methylbutyl)sulfamoyl chloride

N,N-bis(3-methylbutyl)sulfamoyl chloride (PubChem CID 16769428) has the molecular formula C10H22ClNO2S and a molecular weight of 255.81 g/mol. Its IUPAC name is N,N-bis(3-methylbutyl)sulfamoyl chloride.

Molecular Properties

Compound NameN,N-bis(3-methylbutyl)sulfamoyl chloride
PubChem CID16769428
Molecular FormulaC10H22ClNO2S
Molecular Weight255.81 g/mol
Exact Mass255.11
IUPAC NameN,N-bis(3-methylbutyl)sulfamoyl chloride
SMILESCC(C)CCN(CCC(C)C)S(=O)(=O)Cl
InChIInChI=1S/C10H22ClNO2S/c1-9(2)5-7-12(15(11,13)14)8-6-10(3)4/h9-10H,5-8H2,1-4H3
InChIKeyDAPGCOVJHZPQCB-UHFFFAOYSA-N
XLogP2.86
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.81
LogP ≤ 52.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N,N-bis(3-methylbutyl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-bis(3-methylbutyl)sulfamoyl chloride?
The IUPAC name of N,N-bis(3-methylbutyl)sulfamoyl chloride (CID 16769428) is N,N-bis(3-methylbutyl)sulfamoyl chloride.
What is the SMILES notation for N,N-bis(3-methylbutyl)sulfamoyl chloride?
The canonical SMILES for N,N-bis(3-methylbutyl)sulfamoyl chloride is CC(C)CCN(CCC(C)C)S(=O)(=O)Cl.
What is the InChIKey of N,N-bis(3-methylbutyl)sulfamoyl chloride?
The InChIKey is DAPGCOVJHZPQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22ClNO2S/c1-9(2)5-7-12(15(11,13)14)8-6-10(3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of N,N-bis(3-methylbutyl)sulfamoyl chloride?
N,N-bis(3-methylbutyl)sulfamoyl chloride has a molecular weight of 255.81 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(3-methylbutyl)sulfamoyl chloride is sourced from PubChem (CID 16769428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).