About bicyclo[2.2.1]hept-2-ene;2-methylbutane
bicyclo[2.2.1]hept-2-ene;2-methylbutane (PubChem CID 167695695) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;2-methylbutane.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;2-methylbutane |
| PubChem CID | 167695695 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;2-methylbutane |
| SMILES | C1=CC2CCC1C2.CCC(C)C |
| InChI | InChI=1S/C7H10.C5H12/c1-2-7-4-3-6(1)5-7;1-4-5(2)3/h1-2,6-7H,3-5H2;5H,4H2,1-3H3 |
| InChIKey | XPWCUEDMXRVZHM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;2-methylbutane?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;2-methylbutane (CID 167695695) is bicyclo[2.2.1]hept-2-ene;2-methylbutane.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;2-methylbutane?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;2-methylbutane is C1=CC2CCC1C2.CCC(C)C.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;2-methylbutane?
The InChIKey is XPWCUEDMXRVZHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.C5H12/c1-2-7-4-3-6(1)5-7;1-4-5(2)3/h1-2,6-7H,3-5H2;5H,4H2,1-3H3.
What are the key properties of bicyclo[2.2.1]hept-2-ene;2-methylbutane?
bicyclo[2.2.1]hept-2-ene;2-methylbutane has a molecular weight of 166.31 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;2-methylbutane is sourced from PubChem (CID 167695695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).