About 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene
1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene (PubChem CID 167695787) has the molecular formula C17H16F2O2S
and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene |
| PubChem CID | 167695787 |
| Molecular Formula | C17H16F2O2S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene |
| SMILES | Cc1cc(CS(=O)(=O)C2CC2)cc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H16F2O2S/c1-11-6-12(10-22(20,21)15-3-4-15)8-13(7-11)16-5-2-14(18)9-17(16)19/h2,5-9,15H,3-4,10H2,1H3 |
| InChIKey | BBYFATLTEIAKMS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene?
The IUPAC name of 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene (CID 167695787) is 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene.
What is the SMILES notation for 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene?
The canonical SMILES for 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene is Cc1cc(CS(=O)(=O)C2CC2)cc(-c2ccc(F)cc2F)c1.
What is the InChIKey of 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene?
The InChIKey is BBYFATLTEIAKMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2O2S/c1-11-6-12(10-22(20,21)15-3-4-15)8-13(7-11)16-5-2-14(18)9-17(16)19/h2,5-9,15H,3-4,10H2,1H3.
What are the key properties of 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene?
1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene has a molecular weight of 322.38 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(cyclopropylsulfonylmethyl)-5-methylphenyl]-2,4-difluorobenzene is sourced from PubChem (CID 167695787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).