1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid

C13H11Cl2NO2 — CID 16769584

IUPAC1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid
SMILESCc1cc(C(=O)O)c(C)n1-c1cccc(Cl)c1Cl
InChIInChI=1S/C13H11Cl2NO2/c1-7-6-9(13(17)18)8(2)16(7)11-5-3-4-10(14)12(11)15/h3-6H,1-2H3,(H,17,18)
InChIKeyIIWRMWMCQVAZKZ-UHFFFAOYSA-N
MW284.14 g/mol
LogP4.10
Rot. Bonds2

About 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid

1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 16769584) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid
PubChem CID16769584
Molecular FormulaC13H11Cl2NO2
Molecular Weight284.14 g/mol
Exact Mass283.02
IUPAC Name1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid
SMILESCc1cc(C(=O)O)c(C)n1-c1cccc(Cl)c1Cl
InChIInChI=1S/C13H11Cl2NO2/c1-7-6-9(13(17)18)8(2)16(7)11-5-3-4-10(14)12(11)15/h3-6H,1-2H3,(H,17,18)
InChIKeyIIWRMWMCQVAZKZ-UHFFFAOYSA-N
XLogP4.10
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.14
LogP ≤ 54.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}

Analyze 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid?
The IUPAC name of 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid (CID 16769584) is 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid.
What is the SMILES notation for 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid?
The canonical SMILES for 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid is Cc1cc(C(=O)O)c(C)n1-c1cccc(Cl)c1Cl.
What is the InChIKey of 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid?
The InChIKey is IIWRMWMCQVAZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2NO2/c1-7-6-9(13(17)18)8(2)16(7)11-5-3-4-10(14)12(11)15/h3-6H,1-2H3,(H,17,18).
What are the key properties of 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid?
1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid has a molecular weight of 284.14 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid is sourced from PubChem (CID 16769584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).