C22H22N2O4S — CID 167697978
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(6-methoxy-1,3-dioxo-1,2-benzothiazol-1-yl)acetamide (PubChem CID 167697978) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(6-methoxy-1,3-dioxo-1,2-benzothiazol-1-yl)acetamide.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(6-methoxy-1,3-dioxo-1,2-benzothiazol-1-yl)acetamide |
|---|---|
| PubChem CID | 167697978 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-(6-methoxy-1,3-dioxo-1,2-benzothiazol-1-yl)acetamide |
| SMILES | COc1ccc2c(c1)S(=O)(CC(=O)Nc1c3c(cc4c1CCC4)CCC3)=NC2=O |
| InChI | InChI=1S/C22H22N2O4S/c1-28-15-8-9-18-19(11-15)29(27,24-22(18)26)12-20(25)23-21-16-6-2-4-13(16)10-14-5-3-7-17(14)21/h8-11H,2-7,12H2,1H3,(H,23,25) |
| InChIKey | XYJCMXJXKCCDFI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |