C29H29ClF2N6 — CID 167698767
1-[4-[[4-[[2-(5-chloro-2,4-difluorophenyl)pyrimidin-4-yl]methyl]pyrimidin-2-yl]methyl]phenyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 167698767) has the molecular formula C29H29ClF2N6 and a molecular weight of 535.04 g/mol. Its IUPAC name is 1-[4-[[4-[[2-(5-chloro-2,4-difluorophenyl)pyrimidin-4-yl]methyl]pyrimidin-2-yl]methyl]phenyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[4-[[4-[[2-(5-chloro-2,4-difluorophenyl)pyrimidin-4-yl]methyl]pyrimidin-2-yl]methyl]phenyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 167698767 |
| Molecular Formula | C29H29ClF2N6 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 1-[4-[[4-[[2-(5-chloro-2,4-difluorophenyl)pyrimidin-4-yl]methyl]pyrimidin-2-yl]methyl]phenyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCN(c2ccc(Cc3nccc(Cc4ccnc(-c5cc(Cl)c(F)cc5F)n4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H29ClF2N6/c1-37(2)22-9-13-38(14-10-22)23-5-3-19(4-6-23)15-28-33-11-7-20(35-28)16-21-8-12-34-29(36-21)24-17-25(30)27(32)18-26(24)31/h3-8,11-12,17-18,22H,9-10,13-16H2,1-2H3 |
| InChIKey | YBEFBPYCPNHHEF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|