C11H15NO2 — CID 16769880
3-hydroxy-N-(3-methylphenyl)butanamide (PubChem CID 16769880) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-hydroxy-N-(3-methylphenyl)butanamide.
| Compound Name | 3-hydroxy-N-(3-methylphenyl)butanamide |
|---|---|
| PubChem CID | 16769880 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-hydroxy-N-(3-methylphenyl)butanamide |
| SMILES | Cc1cccc(NC(=O)CC(C)O)c1 |
| InChI | InChI=1S/C11H15NO2/c1-8-4-3-5-10(6-8)12-11(14)7-9(2)13/h3-6,9,13H,7H2,1-2H3,(H,12,14) |
| InChIKey | FKSBGLDPKWGWQT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |