3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid

C15H15NO3 — CID 16769933

IUPAC3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid
SMILESCc1cc(C(=O)O)cc(C)c1OCc1cccnc1
InChIInChI=1S/C15H15NO3/c1-10-6-13(15(17)18)7-11(2)14(10)19-9-12-4-3-5-16-8-12/h3-8H,9H2,1-2H3,(H,17,18)
InChIKeyMPXYDASDOGSCFL-UHFFFAOYSA-N
MW257.29 g/mol
LogP2.98
Rot. Bonds4

About 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid

3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid (PubChem CID 16769933) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid.

Molecular Properties

Compound Name3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid
PubChem CID16769933
Molecular FormulaC15H15NO3
Molecular Weight257.29 g/mol
Exact Mass257.11
IUPAC Name3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid
SMILESCc1cc(C(=O)O)cc(C)c1OCc1cccnc1
InChIInChI=1S/C15H15NO3/c1-10-6-13(15(17)18)7-11(2)14(10)19-9-12-4-3-5-16-8-12/h3-8H,9H2,1-2H3,(H,17,18)
InChIKeyMPXYDASDOGSCFL-UHFFFAOYSA-N
XLogP2.98
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.29
LogP ≤ 52.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid?
The IUPAC name of 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid (CID 16769933) is 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid.
What is the SMILES notation for 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid?
The canonical SMILES for 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid is Cc1cc(C(=O)O)cc(C)c1OCc1cccnc1.
What is the InChIKey of 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid?
The InChIKey is MPXYDASDOGSCFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c1-10-6-13(15(17)18)7-11(2)14(10)19-9-12-4-3-5-16-8-12/h3-8H,9H2,1-2H3,(H,17,18).
What are the key properties of 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid?
3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid has a molecular weight of 257.29 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzoic acid is sourced from PubChem (CID 16769933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).