C25H38N6O3SSi — CID 167700576
tert-butyl 3-[[5-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 167700576) has the molecular formula C25H38N6O3SSi and a molecular weight of 530.77 g/mol. Its IUPAC name is tert-butyl 3-[[5-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167700576 |
| Molecular Formula | C25H38N6O3SSi |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | tert-butyl 3-[[5-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2c(-c3nncs3)cnc3c2ccn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C25H38N6O3SSi/c1-25(2,3)34-24(32)30-10-7-8-18(15-30)28-21-19-9-11-31(17-33-12-13-36(4,5)6)22(19)26-14-20(21)23-29-27-16-35-23/h9,11,14,16,18H,7-8,10,12-13,15,17H2,1-6H3,(H,26,28) |
| InChIKey | QWGLBTDYSSUDEI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|