About (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate
(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate (PubChem CID 16770157) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate |
| PubChem CID | 16770157 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CO)C1 |
| InChI | InChI=1S/C12H22O3/c1-8(2)10-5-4-9(3)6-11(10)15-12(14)7-13/h8-11,13H,4-7H2,1-3H3 |
| InChIKey | FMATXKUIGQODAH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate (CID 16770157) is (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate is CC1CCC(C(C)C)C(OC(=O)CO)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate?
The InChIKey is FMATXKUIGQODAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-8(2)10-5-4-9(3)6-11(10)15-12(14)7-13/h8-11,13H,4-7H2,1-3H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate?
(5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate has a molecular weight of 214.30 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) 2-hydroxyacetate is sourced from PubChem (CID 16770157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).