C31H24O10S2 — CID 167702100
2,3-dihydroxy-4-(4-methylphenyl)sulfonylcyclohepta-2,4,6-trien-1-one;2,3-dihydroxy-4-naphthalen-1-ylsulfonylcyclohepta-2,4,6-trien-1-one (PubChem CID 167702100) has the molecular formula C31H24O10S2 and a molecular weight of 620.66 g/mol. Its IUPAC name is 2,3-dihydroxy-4-(4-methylphenyl)sulfonylcyclohepta-2,4,6-trien-1-one;2,3-dihydroxy-4-naphthalen-1-ylsulfonylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 2,3-dihydroxy-4-(4-methylphenyl)sulfonylcyclohepta-2,4,6-trien-1-one;2,3-dihydroxy-4-naphthalen-1-ylsulfonylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 167702100 |
| Molecular Formula | C31H24O10S2 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | 2,3-dihydroxy-4-(4-methylphenyl)sulfonylcyclohepta-2,4,6-trien-1-one;2,3-dihydroxy-4-naphthalen-1-ylsulfonylcyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1ccc(S(=O)(=O)c2cccc(=O)c(O)c2O)cc1.O=c1cccc(S(=O)(=O)c2cccc3ccccc23)c(O)c1O |
| InChI | InChI=1S/C17H12O5S.C14H12O5S/c18-13-8-4-10-15(17(20)16(13)19)23(21,22)14-9-3-6-11-5-1-2-7-12(11)14;1-9-5-7-10(8-6-9)20(18,19)12-4-2-3-11(15)13(16)14(12)17/h1-10H,(H2,18,19,20);2-8H,1H3,(H2,15,16,17) |
| InChIKey | YNVFLIUVYXCMDE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |