C21H23ClN4O3 — CID 167702296
6-[(5-chloro-2-methylpyrimidin-4-yl)amino]-3-(2-oxobutoxy)-1-propan-2-ylquinolin-2-one (PubChem CID 167702296) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 6-[(5-chloro-2-methylpyrimidin-4-yl)amino]-3-(2-oxobutoxy)-1-propan-2-ylquinolin-2-one.
| Compound Name | 6-[(5-chloro-2-methylpyrimidin-4-yl)amino]-3-(2-oxobutoxy)-1-propan-2-ylquinolin-2-one |
|---|---|
| PubChem CID | 167702296 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 6-[(5-chloro-2-methylpyrimidin-4-yl)amino]-3-(2-oxobutoxy)-1-propan-2-ylquinolin-2-one |
| SMILES | CCC(=O)COc1cc2cc(Nc3nc(C)ncc3Cl)ccc2n(C(C)C)c1=O |
| InChI | InChI=1S/C21H23ClN4O3/c1-5-16(27)11-29-19-9-14-8-15(25-20-17(22)10-23-13(4)24-20)6-7-18(14)26(12(2)3)21(19)28/h6-10,12H,5,11H2,1-4H3,(H,23,24,25) |
| InChIKey | HKFSOCJJCISAKA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |