About 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid
6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid (PubChem CID 16770290) has the molecular formula C10H8ClNO5S
and a molecular weight of 289.70 g/mol. Its IUPAC name is 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid |
| PubChem CID | 16770290 |
| Molecular Formula | C10H8ClNO5S |
| Molecular Weight | 289.70 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)c2cc(S(=O)(=O)Cl)ccc2N1 |
| InChI | InChI=1S/C10H8ClNO5S/c11-18(16,17)5-1-2-8-6(3-5)7(10(14)15)4-9(13)12-8/h1-3,7H,4H2,(H,12,13)(H,14,15) |
| InChIKey | XZAMNOWDWWKUGQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.70 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid?
The IUPAC name of 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid (CID 16770290) is 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid.
What is the SMILES notation for 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid?
The canonical SMILES for 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid is O=C1CC(C(=O)O)c2cc(S(=O)(=O)Cl)ccc2N1.
What is the InChIKey of 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid?
The InChIKey is XZAMNOWDWWKUGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO5S/c11-18(16,17)5-1-2-8-6(3-5)7(10(14)15)4-9(13)12-8/h1-3,7H,4H2,(H,12,13)(H,14,15).
What are the key properties of 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid?
6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid has a molecular weight of 289.70 g/mol, XLogP of 1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorosulfonyl-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid is sourced from PubChem (CID 16770290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).