C6H7N5 — CID 16770347
[1,2,4]triazolo[4,3-a]pyrazin-3-ylmethanamine (PubChem CID 16770347) has the molecular formula C6H7N5 and a molecular weight of 149.16 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-a]pyrazin-3-ylmethanamine.
| Compound Name | [1,2,4]triazolo[4,3-a]pyrazin-3-ylmethanamine |
|---|---|
| PubChem CID | 16770347 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | [1,2,4]triazolo[4,3-a]pyrazin-3-ylmethanamine |
| SMILES | NCc1nnc2cnccn12 |
| InChI | InChI=1S/C6H7N5/c7-3-5-9-10-6-4-8-1-2-11(5)6/h1-2,4H,3,7H2 |
| InChIKey | UZPUUBPBKMYCNN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |