About 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione
3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione (PubChem CID 167703906) has the molecular formula C20H15Cl2N3O3
and a molecular weight of 416.26 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione.
Molecular Properties
| Compound Name | 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione |
| PubChem CID | 167703906 |
| Molecular Formula | C20H15Cl2N3O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione |
| SMILES | CCC1=NCc2ccc(Oc3c(Cl)cc(C4=NNC(=O)CC4=O)cc3Cl)cc21 |
| InChI | InChI=1S/C20H15Cl2N3O3/c1-2-16-13-7-12(4-3-10(13)9-23-16)28-20-14(21)5-11(6-15(20)22)19-17(26)8-18(27)24-25-19/h3-7H,2,8-9H2,1H3,(H,24,27) |
| InChIKey | YUSXPUHAZGXCLO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione?
The IUPAC name of 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione (CID 167703906) is 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione.
What is the SMILES notation for 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione?
The canonical SMILES for 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione is CCC1=NCc2ccc(Oc3c(Cl)cc(C4=NNC(=O)CC4=O)cc3Cl)cc21.
What is the InChIKey of 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione?
The InChIKey is YUSXPUHAZGXCLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2N3O3/c1-2-16-13-7-12(4-3-10(13)9-23-16)28-20-14(21)5-11(6-15(20)22)19-17(26)8-18(27)24-25-19/h3-7H,2,8-9H2,1H3,(H,24,27).
What are the key properties of 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione?
3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione has a molecular weight of 416.26 g/mol, XLogP of 4.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dichloro-4-[(3-ethyl-1H-isoindol-5-yl)oxy]phenyl]-1H-pyridazine-4,6-dione is sourced from PubChem (CID 167703906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).