C15H21NO — CID 167703918
(5aR,9aS)-6,6,9a-trimethyl-2,4,5,5a,8,9-hexahydrobenzo[g]indol-7-one (PubChem CID 167703918) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (5aR,9aS)-6,6,9a-trimethyl-2,4,5,5a,8,9-hexahydrobenzo[g]indol-7-one.
| Compound Name | (5aR,9aS)-6,6,9a-trimethyl-2,4,5,5a,8,9-hexahydrobenzo[g]indol-7-one |
|---|---|
| PubChem CID | 167703918 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (5aR,9aS)-6,6,9a-trimethyl-2,4,5,5a,8,9-hexahydrobenzo[g]indol-7-one |
| SMILES | CC1(C)C(=O)CC[C@]2(C)C3=NCC=C3CC[C@@H]12 |
| InChI | InChI=1S/C15H21NO/c1-14(2)11-5-4-10-7-9-16-13(10)15(11,3)8-6-12(14)17/h7,11H,4-6,8-9H2,1-3H3/t11-,15-/m0/s1 |
| InChIKey | TZPNCOCDZLRURD-NHYWBVRUSA-N |
| XLogP | 3.17 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |