C48H84O6 — CID 167704086
(10Z)-15-ethyl-1-oxacyclopentadec-10-en-2-one;(10Z)-16-methyl-1-oxacyclohexadec-10-en-2-one;(10Z)-14-propyl-1-oxacyclotetradec-10-en-2-one (PubChem CID 167704086) has the molecular formula C48H84O6 and a molecular weight of 757.19 g/mol. Its IUPAC name is (10Z)-15-ethyl-1-oxacyclopentadec-10-en-2-one;(10Z)-16-methyl-1-oxacyclohexadec-10-en-2-one;(10Z)-14-propyl-1-oxacyclotetradec-10-en-2-one.
| Compound Name | (10Z)-15-ethyl-1-oxacyclopentadec-10-en-2-one;(10Z)-16-methyl-1-oxacyclohexadec-10-en-2-one;(10Z)-14-propyl-1-oxacyclotetradec-10-en-2-one |
|---|---|
| PubChem CID | 167704086 |
| Molecular Formula | C48H84O6 |
| Molecular Weight | 757.19 g/mol |
| Exact Mass | 756.63 |
| IUPAC Name | (10Z)-15-ethyl-1-oxacyclopentadec-10-en-2-one;(10Z)-16-methyl-1-oxacyclohexadec-10-en-2-one;(10Z)-14-propyl-1-oxacyclotetradec-10-en-2-one |
| SMILES | CC1CCCC/C=C\CCCCCCCC(=O)O1.CCC1CCC/C=C\CCCCCCCC(=O)O1.CCCC1CC/C=C\CCCCCCCC(=O)O1 |
| InChI | InChI=1S/3C16H28O2/c1-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16(17)18-15;1-2-15-13-11-9-7-5-3-4-6-8-10-12-14-16(17)18-15;1-2-12-15-13-10-8-6-4-3-5-7-9-11-14-16(17)18-15/h3,5,15H,2,4,6-14H2,1H3;5,7,15H,2-4,6,8-14H2,1H3;6,8,15H,2-5,7,9-14H2,1H3/b5-3-;7-5-;8-6- |
| InChIKey | YVLRMFRJNUXZQR-HMABRVPWSA-N |
| XLogP | 14.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.19 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|