C21H25F3N4O3 — CID 167704155
(2E,4E)-N-[(4E,5Z)-4-(1-methoxyethylidene)-5-[1-(1-methylpyrazol-4-yl)ethylidene]-3H-pyrrol-2-yl]-2-methyl-5-(trifluoromethoxy)hexa-2,4-dienamide (PubChem CID 167704155) has the molecular formula C21H25F3N4O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is (2E,4E)-N-[(4E,5Z)-4-(1-methoxyethylidene)-5-[1-(1-methylpyrazol-4-yl)ethylidene]-3H-pyrrol-2-yl]-2-methyl-5-(trifluoromethoxy)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(4E,5Z)-4-(1-methoxyethylidene)-5-[1-(1-methylpyrazol-4-yl)ethylidene]-3H-pyrrol-2-yl]-2-methyl-5-(trifluoromethoxy)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 167704155 |
| Molecular Formula | C21H25F3N4O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (2E,4E)-N-[(4E,5Z)-4-(1-methoxyethylidene)-5-[1-(1-methylpyrazol-4-yl)ethylidene]-3H-pyrrol-2-yl]-2-methyl-5-(trifluoromethoxy)hexa-2,4-dienamide |
| SMILES | CO/C(C)=C1\CC(NC(=O)/C(C)=C/C=C(\C)OC(F)(F)F)=N\C1=C(\C)c1cnn(C)c1 |
| InChI | InChI=1S/C21H25F3N4O3/c1-12(7-8-13(2)31-21(22,23)24)20(29)27-18-9-17(15(4)30-6)19(26-18)14(3)16-10-25-28(5)11-16/h7-8,10-11H,9H2,1-6H3,(H,26,27,29)/b12-7+,13-8+,17-15+,19-14- |
| InChIKey | YVSFBRXQNZZDEP-KVJJTKDWSA-N |
| XLogP | 4.38 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|