C13H27NO — CID 167704362
1,6-di(propan-2-yl)piperidin-2-one;ethane (PubChem CID 167704362) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 1,6-di(propan-2-yl)piperidin-2-one;ethane.
| Compound Name | 1,6-di(propan-2-yl)piperidin-2-one;ethane |
|---|---|
| PubChem CID | 167704362 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1,6-di(propan-2-yl)piperidin-2-one;ethane |
| SMILES | CC.CC(C)C1CCCC(=O)N1C(C)C |
| InChI | InChI=1S/C11H21NO.C2H6/c1-8(2)10-6-5-7-11(13)12(10)9(3)4;1-2/h8-10H,5-7H2,1-4H3;1-2H3 |
| InChIKey | YWJVXVWUYSSCRW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |