C14H12F4N2O6S2 — CID 167706684
2,3-difluoro-4-methylbenzenesulfonamide;2,3-difluoro-4-sulfamoylbenzoic acid (PubChem CID 167706684) has the molecular formula C14H12F4N2O6S2 and a molecular weight of 444.38 g/mol. Its IUPAC name is 2,3-difluoro-4-methylbenzenesulfonamide;2,3-difluoro-4-sulfamoylbenzoic acid.
| Compound Name | 2,3-difluoro-4-methylbenzenesulfonamide;2,3-difluoro-4-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 167706684 |
| Molecular Formula | C14H12F4N2O6S2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 2,3-difluoro-4-methylbenzenesulfonamide;2,3-difluoro-4-sulfamoylbenzoic acid |
| SMILES | Cc1ccc(S(N)(=O)=O)c(F)c1F.NS(=O)(=O)c1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C7H5F2NO4S.C7H7F2NO2S/c8-5-3(7(11)12)1-2-4(6(5)9)15(10,13)14;1-4-2-3-5(13(10,11)12)7(9)6(4)8/h1-2H,(H,11,12)(H2,10,13,14);2-3H,1H3,(H2,10,11,12) |
| InChIKey | ZEUQXIGANUOQRQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |