C15H24N4O — CID 167707987
4-amino-N-(1,3-dimethyl-1,3-diazinan-2-ylidene)benzamide;ethane (PubChem CID 167707987) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-amino-N-(1,3-dimethyl-1,3-diazinan-2-ylidene)benzamide;ethane.
| Compound Name | 4-amino-N-(1,3-dimethyl-1,3-diazinan-2-ylidene)benzamide;ethane |
|---|---|
| PubChem CID | 167707987 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-amino-N-(1,3-dimethyl-1,3-diazinan-2-ylidene)benzamide;ethane |
| SMILES | CC.CN1CCCN(C)C1=NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N4O.C2H6/c1-16-8-3-9-17(2)13(16)15-12(18)10-4-6-11(14)7-5-10;1-2/h4-7H,3,8-9,14H2,1-2H3;1-2H3 |
| InChIKey | ZJWRBEHRVAMFMQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|