C22H23Cl3N2O6S2 — CID 167708402
2-(4-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one;2-(3,4-dichlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one (PubChem CID 167708402) has the molecular formula C22H23Cl3N2O6S2 and a molecular weight of 581.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one;2-(3,4-dichlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one.
| Compound Name | 2-(4-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one;2-(3,4-dichlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 167708402 |
| Molecular Formula | C22H23Cl3N2O6S2 |
| Molecular Weight | 581.93 g/mol |
| Exact Mass | 580.01 |
| IUPAC Name | 2-(4-chlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one;2-(3,4-dichlorophenyl)-3-methyl-1,1-dioxo-1,3-thiazinan-4-one |
| SMILES | CN1C(=O)CCS(=O)(=O)C1c1ccc(Cl)c(Cl)c1.CN1C(=O)CCS(=O)(=O)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11Cl2NO3S.C11H12ClNO3S/c1-14-10(15)4-5-18(16,17)11(14)7-2-3-8(12)9(13)6-7;1-13-10(14)6-7-17(15,16)11(13)8-2-4-9(12)5-3-8/h2-3,6,11H,4-5H2,1H3;2-5,11H,6-7H2,1H3 |
| InChIKey | ZLNLGHATAARYBQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.93 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |