About 4-amino-2-chloro-N,N-diethylbenzamide
4-amino-2-chloro-N,N-diethylbenzamide (PubChem CID 16770890) has the molecular formula C11H15ClN2O
and a molecular weight of 226.71 g/mol. Its IUPAC name is 4-amino-2-chloro-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 4-amino-2-chloro-N,N-diethylbenzamide |
| PubChem CID | 16770890 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-amino-2-chloro-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C11H15ClN2O/c1-3-14(4-2)11(15)9-6-5-8(13)7-10(9)12/h5-7H,3-4,13H2,1-2H3 |
| InChIKey | RJFITOJPVXDCPN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-chloro-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-chloro-N,N-diethylbenzamide?
The IUPAC name of 4-amino-2-chloro-N,N-diethylbenzamide (CID 16770890) is 4-amino-2-chloro-N,N-diethylbenzamide.
What is the SMILES notation for 4-amino-2-chloro-N,N-diethylbenzamide?
The canonical SMILES for 4-amino-2-chloro-N,N-diethylbenzamide is CCN(CC)C(=O)c1ccc(N)cc1Cl.
What is the InChIKey of 4-amino-2-chloro-N,N-diethylbenzamide?
The InChIKey is RJFITOJPVXDCPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O/c1-3-14(4-2)11(15)9-6-5-8(13)7-10(9)12/h5-7H,3-4,13H2,1-2H3.
What are the key properties of 4-amino-2-chloro-N,N-diethylbenzamide?
4-amino-2-chloro-N,N-diethylbenzamide has a molecular weight of 226.71 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-chloro-N,N-diethylbenzamide is sourced from PubChem (CID 16770890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).