About 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide
2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide (PubChem CID 167709394) has the molecular formula C15H10BrFN2O3
and a molecular weight of 365.16 g/mol. Its IUPAC name is 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide.
Molecular Properties
| Compound Name | 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide |
| PubChem CID | 167709394 |
| Molecular Formula | C15H10BrFN2O3 |
| Molecular Weight | 365.16 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide |
| SMILES | O=C1c2nc(Br)ccc2CN1Cc1cccc(F)c1.O=C=O |
| InChI | InChI=1S/C14H10BrFN2O.CO2/c15-12-5-4-10-8-18(14(19)13(10)17-12)7-9-2-1-3-11(16)6-9;2-1-3/h1-6H,7-8H2; |
| InChIKey | ZOXUMBOVKDYQBC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide?
The IUPAC name of 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide (CID 167709394) is 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide.
What is the SMILES notation for 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide?
The canonical SMILES for 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide is O=C1c2nc(Br)ccc2CN1Cc1cccc(F)c1.O=C=O.
What is the InChIKey of 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide?
The InChIKey is ZOXUMBOVKDYQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrFN2O.CO2/c15-12-5-4-10-8-18(14(19)13(10)17-12)7-9-2-1-3-11(16)6-9;2-1-3/h1-6H,7-8H2;.
What are the key properties of 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide?
2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide has a molecular weight of 365.16 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-[(3-fluorophenyl)methyl]-5H-pyrrolo[3,4-b]pyridin-7-one;carbon dioxide is sourced from PubChem (CID 167709394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).