About methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate
methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate (PubChem CID 167713261) has the molecular formula C15H19N3O3
and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate |
| PubChem CID | 167713261 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1n[nH]c2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C15H19N3O3/c1-15(2,3)12(14(20)21-4)16-13(19)11-9-7-5-6-8-10(9)17-18-11/h5-8,12H,1-4H3,(H,16,19)(H,17,18)/t12-/m1/s1 |
| InChIKey | QEXPVGIGOZJEOO-GFCCVEGCSA-N |
| XLogP | 1.88 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate?
The IUPAC name of methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate (CID 167713261) is methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate.
What is the SMILES notation for methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate?
The canonical SMILES for methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate is COC(=O)[C@@H](NC(=O)c1n[nH]c2ccccc12)C(C)(C)C.
What is the InChIKey of methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate?
The InChIKey is QEXPVGIGOZJEOO-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-15(2,3)12(14(20)21-4)16-13(19)11-9-7-5-6-8-10(9)17-18-11/h5-8,12H,1-4H3,(H,16,19)(H,17,18)/t12-/m1/s1.
What are the key properties of methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate?
methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate has a molecular weight of 289.33 g/mol, XLogP of 1.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoate is sourced from PubChem (CID 167713261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).