About 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide
8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide (PubChem CID 167713518) has the molecular formula C14H20BrNO
and a molecular weight of 298.22 g/mol. Its IUPAC name is 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide.
Molecular Properties
| Compound Name | 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide |
| PubChem CID | 167713518 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide |
| SMILES | C=CCc1cccc2c1OC[NH+](CCC)C2.[Br-] |
| InChI | InChI=1S/C14H19NO.BrH/c1-3-6-12-7-5-8-13-10-15(9-4-2)11-16-14(12)13;/h3,5,7-8H,1,4,6,9-11H2,2H3;1H |
| InChIKey | ZKMRDEVHGOMGQD-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide?
The IUPAC name of 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide (CID 167713518) is 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide.
What is the SMILES notation for 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide?
The canonical SMILES for 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide is C=CCc1cccc2c1OC[NH+](CCC)C2.[Br-].
What is the InChIKey of 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide?
The InChIKey is ZKMRDEVHGOMGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO.BrH/c1-3-6-12-7-5-8-13-10-15(9-4-2)11-16-14(12)13;/h3,5,7-8H,1,4,6,9-11H2,2H3;1H.
What are the key properties of 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide?
8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide has a molecular weight of 298.22 g/mol, XLogP of -1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide is sourced from PubChem (CID 167713518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).