C14H20BrNO — CID 167713518
8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide (PubChem CID 167713518) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide.
| Compound Name | 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide |
|---|---|
| PubChem CID | 167713518 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 8-prop-2-enyl-3-propyl-3,4-dihydro-2H-1,3-benzoxazin-3-ium bromide |
| SMILES | C=CCc1cccc2c1OC[NH+](CCC)C2.[Br-] |
| InChI | InChI=1S/C14H19NO.BrH/c1-3-6-12-7-5-8-13-10-15(9-4-2)11-16-14(12)13;/h3,5,7-8H,1,4,6,9-11H2,2H3;1H |
| InChIKey | ZKMRDEVHGOMGQD-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|