About benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate
benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate (PubChem CID 167713532) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 167713532 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)(C)c1ocnc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H17NO3/c1-15(2,3)13-12(16-10-19-13)14(17)18-9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3 |
| InChIKey | HXMSZYSUMSDVLW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate?
The IUPAC name of benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate (CID 167713532) is benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate is CC(C)(C)c1ocnc1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate?
The InChIKey is HXMSZYSUMSDVLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-15(2,3)13-12(16-10-19-13)14(17)18-9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3.
What are the key properties of benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate?
benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate has a molecular weight of 259.31 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-tert-butyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 167713532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).