C27H51NO8P- — CID 167714243
2-[[(2S)-2-[(E)-dodec-9-enoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 167714243) has the molecular formula C27H51NO8P- and a molecular weight of 548.68 g/mol. Its IUPAC name is 2-[[(2S)-2-[(E)-dodec-9-enoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2S)-2-[(E)-dodec-9-enoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 167714243 |
| Molecular Formula | C27H51NO8P- |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 2-[[(2S)-2-[(E)-dodec-9-enoyl]oxy-3-heptanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | [CH2-]C/C=C/CCCCCCCC(=O)O[C@@H](COC(=O)CCCCC[CH2-])COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C27H51NO8P/c1-6-8-10-12-13-14-15-16-18-20-27(30)36-25(23-33-26(29)19-17-11-9-7-2)24-35-37(31,32)34-22-21-28(3,4)5/h8,10,25H,1-2,6-7,9,11-24H2,3-5H3,(H,31,32)/q-1/b10-8+/t25-/m0/s1 |
| InChIKey | VSQAKOKAXRKTHY-NRGMSUJUSA-N |
| XLogP | 5.58 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|