About 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride
6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride (PubChem CID 167714486) has the molecular formula C11H16Cl2O3SSi
and a molecular weight of 327.31 g/mol. Its IUPAC name is 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride |
| PubChem CID | 167714486 |
| Molecular Formula | C11H16Cl2O3SSi |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride |
| SMILES | Cc1cc(Cl)c(S(=O)(=O)Cl)c(C)c1O[Si](C)(C)C |
| InChI | InChI=1S/C11H16Cl2O3SSi/c1-7-6-9(12)11(17(13,14)15)8(2)10(7)16-18(3,4)5/h6H,1-5H3 |
| InChIKey | HIDSBAMWCWEKTM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride?
The IUPAC name of 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride (CID 167714486) is 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride.
What is the SMILES notation for 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride?
The canonical SMILES for 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride is Cc1cc(Cl)c(S(=O)(=O)Cl)c(C)c1O[Si](C)(C)C.
What is the InChIKey of 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride?
The InChIKey is HIDSBAMWCWEKTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16Cl2O3SSi/c1-7-6-9(12)11(17(13,14)15)8(2)10(7)16-18(3,4)5/h6H,1-5H3.
What are the key properties of 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride?
6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride has a molecular weight of 327.31 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,4-dimethyl-3-trimethylsilyloxybenzenesulfonyl chloride is sourced from PubChem (CID 167714486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).