C7H9F2N3 — CID 167714971
6,6-difluoro-1,4,5,7-tetrahydrobenzimidazol-2-amine (PubChem CID 167714971) has the molecular formula C7H9F2N3 and a molecular weight of 173.17 g/mol. Its IUPAC name is 6,6-difluoro-1,4,5,7-tetrahydrobenzimidazol-2-amine.
| Compound Name | 6,6-difluoro-1,4,5,7-tetrahydrobenzimidazol-2-amine |
|---|---|
| PubChem CID | 167714971 |
| Molecular Formula | C7H9F2N3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 6,6-difluoro-1,4,5,7-tetrahydrobenzimidazol-2-amine |
| SMILES | Nc1nc2c([nH]1)CC(F)(F)CC2 |
| InChI | InChI=1S/C7H9F2N3/c8-7(9)2-1-4-5(3-7)12-6(10)11-4/h1-3H2,(H3,10,11,12) |
| InChIKey | ZGLTYRVSIKUYJV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |