C27H28N4O5 — CID 167715264
3-[3-oxo-6-[(2-oxospiro[1H-3,1-benzoxazine-4,4'-azepane]-1'-yl)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167715264) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 3-[3-oxo-6-[(2-oxospiro[1H-3,1-benzoxazine-4,4'-azepane]-1'-yl)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(2-oxospiro[1H-3,1-benzoxazine-4,4'-azepane]-1'-yl)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167715264 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3-[3-oxo-6-[(2-oxospiro[1H-3,1-benzoxazine-4,4'-azepane]-1'-yl)methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCCC5(CC4)OC(=O)Nc4ccccc45)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H28N4O5/c32-23-9-8-22(24(33)29-23)31-16-18-14-17(6-7-19(18)25(31)34)15-30-12-3-10-27(11-13-30)20-4-1-2-5-21(20)28-26(35)36-27/h1-2,4-7,14,22H,3,8-13,15-16H2,(H,28,35)(H,29,32,33) |
| InChIKey | GDJFFIHLSWSWPO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|