About [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride
[(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride (PubChem CID 167716168) has the molecular formula C6H16Cl2N2O
and a molecular weight of 203.11 g/mol. Its IUPAC name is [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride.
Molecular Properties
| Compound Name | [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride |
| PubChem CID | 167716168 |
| Molecular Formula | C6H16Cl2N2O |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride |
| SMILES | CN1C[C@H](N)C[C@H]1CO.Cl.Cl |
| InChI | InChI=1S/C6H14N2O.2ClH/c1-8-3-5(7)2-6(8)4-9;;/h5-6,9H,2-4,7H2,1H3;2*1H/t5-,6+;;/m1../s1 |
| InChIKey | PEWAQQIXOIAZLO-PVNUIUKASA-N |
| XLogP | -0.15 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride?
The IUPAC name of [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride (CID 167716168) is [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride.
What is the SMILES notation for [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride?
The canonical SMILES for [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride is CN1C[C@H](N)C[C@H]1CO.Cl.Cl.
What is the InChIKey of [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride?
The InChIKey is PEWAQQIXOIAZLO-PVNUIUKASA-N. The full InChI is InChI=1S/C6H14N2O.2ClH/c1-8-3-5(7)2-6(8)4-9;;/h5-6,9H,2-4,7H2,1H3;2*1H/t5-,6+;;/m1../s1.
What are the key properties of [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride?
[(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride has a molecular weight of 203.11 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-4-amino-1-methylpyrrolidin-2-yl]methanol;dihydrochloride is sourced from PubChem (CID 167716168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).