About 1-chloro-5,6-difluorophthalazine
1-chloro-5,6-difluorophthalazine (PubChem CID 167716175) has the molecular formula C8H3ClF2N2
and a molecular weight of 200.58 g/mol. Its IUPAC name is 1-chloro-5,6-difluorophthalazine.
Molecular Properties
| Compound Name | 1-chloro-5,6-difluorophthalazine |
| PubChem CID | 167716175 |
| Molecular Formula | C8H3ClF2N2 |
| Molecular Weight | 200.58 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 1-chloro-5,6-difluorophthalazine |
| SMILES | Fc1ccc2c(Cl)nncc2c1F |
| InChI | InChI=1S/C8H3ClF2N2/c9-8-4-1-2-6(10)7(11)5(4)3-12-13-8/h1-3H |
| InChIKey | YLWRAPHWQLEBME-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-5,6-difluorophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5,6-difluorophthalazine?
The IUPAC name of 1-chloro-5,6-difluorophthalazine (CID 167716175) is 1-chloro-5,6-difluorophthalazine.
What is the SMILES notation for 1-chloro-5,6-difluorophthalazine?
The canonical SMILES for 1-chloro-5,6-difluorophthalazine is Fc1ccc2c(Cl)nncc2c1F.
What is the InChIKey of 1-chloro-5,6-difluorophthalazine?
The InChIKey is YLWRAPHWQLEBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClF2N2/c9-8-4-1-2-6(10)7(11)5(4)3-12-13-8/h1-3H.
What are the key properties of 1-chloro-5,6-difluorophthalazine?
1-chloro-5,6-difluorophthalazine has a molecular weight of 200.58 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5,6-difluorophthalazine is sourced from PubChem (CID 167716175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).