(Z)-3-bromoprop-2-ene-1-sulfonyl chloride

C3H4BrClO2S — CID 167716457

IUPAC(Z)-3-bromoprop-2-ene-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C/C=C\Br
InChIInChI=1S/C3H4BrClO2S/c4-2-1-3-8(5,6)7/h1-2H,3H2/b2-1-
InChIKeyXRVUKQKOWRSTOH-UPHRSURJSA-N
MW219.49 g/mol
LogP1.46
Rot. Bonds2

About (Z)-3-bromoprop-2-ene-1-sulfonyl chloride

(Z)-3-bromoprop-2-ene-1-sulfonyl chloride (PubChem CID 167716457) has the molecular formula C3H4BrClO2S and a molecular weight of 219.49 g/mol. Its IUPAC name is (Z)-3-bromoprop-2-ene-1-sulfonyl chloride.

Molecular Properties

Compound Name(Z)-3-bromoprop-2-ene-1-sulfonyl chloride
PubChem CID167716457
Molecular FormulaC3H4BrClO2S
Molecular Weight219.49 g/mol
Exact Mass217.88
IUPAC Name(Z)-3-bromoprop-2-ene-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C/C=C\Br
InChIInChI=1S/C3H4BrClO2S/c4-2-1-3-8(5,6)7/h1-2H,3H2/b2-1-
InChIKeyXRVUKQKOWRSTOH-UPHRSURJSA-N
XLogP1.46
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.49
LogP ≤ 51.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (Z)-3-bromoprop-2-ene-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Prop-2-ene-1-sulfonyl chloride
CID 534496
(2Z)-3-bromoprop-2-ene-1-sulfonyl chloride
CID 87271861
Prop-2-ene-1-sulfonyl bromide
CID 21400636
3-Bromoprop-2-ene-1-sulfonyl fluoride
CID 167734077
1-Bromo-3-sulfonylprop-1-ene
CID 53976376
3-Bromoprop-2-ene-1-sulfinate
CID 57291832
3-Bromoprop-1-ene-1-sulfonic acid
CID 58730036
1-Bromoprop-2-ene-1-sulfonyl chloride
CID 87271860
Chloro prop-2-ene-1-sulfonate
CID 141754491
(Z)-4-bromobut-2-ene-1-sulfonyl chloride
CID 152886663
3-Bromoprop-2-ene-1-sulfonyl chloride
CID 171338181
Bromo prop-2-ene-1-sulfonate
CID 174929783

Frequently Asked Questions

What is the IUPAC name of (Z)-3-bromoprop-2-ene-1-sulfonyl chloride?
The IUPAC name of (Z)-3-bromoprop-2-ene-1-sulfonyl chloride (CID 167716457) is (Z)-3-bromoprop-2-ene-1-sulfonyl chloride.
What is the SMILES notation for (Z)-3-bromoprop-2-ene-1-sulfonyl chloride?
The canonical SMILES for (Z)-3-bromoprop-2-ene-1-sulfonyl chloride is O=S(=O)(Cl)C/C=C\Br.
What is the InChIKey of (Z)-3-bromoprop-2-ene-1-sulfonyl chloride?
The InChIKey is XRVUKQKOWRSTOH-UPHRSURJSA-N. The full InChI is InChI=1S/C3H4BrClO2S/c4-2-1-3-8(5,6)7/h1-2H,3H2/b2-1-.
What are the key properties of (Z)-3-bromoprop-2-ene-1-sulfonyl chloride?
(Z)-3-bromoprop-2-ene-1-sulfonyl chloride has a molecular weight of 219.49 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-bromoprop-2-ene-1-sulfonyl chloride is sourced from PubChem (CID 167716457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).