C18H21F3N4O3 — CID 167716609
3-[4-[[(2-amino-4,4,4-trifluorobutyl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167716609) has the molecular formula C18H21F3N4O3 and a molecular weight of 398.39 g/mol. Its IUPAC name is 3-[4-[[(2-amino-4,4,4-trifluorobutyl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[(2-amino-4,4,4-trifluorobutyl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167716609 |
| Molecular Formula | C18H21F3N4O3 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-[4-[[(2-amino-4,4,4-trifluorobutyl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC(CNCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2)CC(F)(F)F |
| InChI | InChI=1S/C18H21F3N4O3/c19-18(20,21)6-12(22)8-23-7-10-2-1-3-11-9-25(17(28)15(10)11)13-4-5-14(26)24-16(13)27/h1-3,12-13,23H,4-9,22H2,(H,24,26,27) |
| InChIKey | CWWVVZQUANTBKD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|