C20H26N4O4 — CID 167717028
3-[6-[[(3R,4R)-4-amino-3-(hydroxymethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167717028) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[6-[[(3R,4R)-4-amino-3-(hydroxymethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(3R,4R)-4-amino-3-(hydroxymethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167717028 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[6-[[(3R,4R)-4-amino-3-(hydroxymethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | N[C@@H]1CCN(Cc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C[C@H]1CO |
| InChI | InChI=1S/C20H26N4O4/c21-16-5-6-23(9-14(16)11-25)8-12-1-2-15-13(7-12)10-24(20(15)28)17-3-4-18(26)22-19(17)27/h1-2,7,14,16-17,25H,3-6,8-11,21H2,(H,22,26,27)/t14-,16+,17?/m0/s1 |
| InChIKey | HZYHUPLGVWHRIE-NOYLFRNESA-N |
| XLogP | -0.41 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|