C22H31NO6 — CID 16771730
1-(3,4,5-triethoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 16771730) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is 1-(3,4,5-triethoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-(3,4,5-triethoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 16771730 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-(3,4,5-triethoxybenzoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CCOc1cc(C(=O)N2C(C(=O)O)CC3CCCCC32)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H31NO6/c1-4-27-18-12-15(13-19(28-5-2)20(18)29-6-3)21(24)23-16-10-8-7-9-14(16)11-17(23)22(25)26/h12-14,16-17H,4-11H2,1-3H3,(H,25,26) |
| InChIKey | WDTXMZSANMSIDF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |