C8H11F3N2O3 — CID 167718059
4-[(2,2,2-trifluoroacetyl)amino]piperidine-4-carboxylic acid (PubChem CID 167718059) has the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. Its IUPAC name is 4-[(2,2,2-trifluoroacetyl)amino]piperidine-4-carboxylic acid.
| Compound Name | 4-[(2,2,2-trifluoroacetyl)amino]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 167718059 |
| Molecular Formula | C8H11F3N2O3 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-[(2,2,2-trifluoroacetyl)amino]piperidine-4-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O3/c9-8(10,11)5(14)13-7(6(15)16)1-3-12-4-2-7/h12H,1-4H2,(H,13,14)(H,15,16) |
| InChIKey | ZDGFGZVGIJEFEM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |