C25H26F2N4O3 — CID 167718537
3-[5-[[(3S,4R)-3-amino-4-[difluoro(phenyl)methyl]pyrrolidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167718537) has the molecular formula C25H26F2N4O3 and a molecular weight of 468.50 g/mol. Its IUPAC name is 3-[5-[[(3S,4R)-3-amino-4-[difluoro(phenyl)methyl]pyrrolidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[(3S,4R)-3-amino-4-[difluoro(phenyl)methyl]pyrrolidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167718537 |
| Molecular Formula | C25H26F2N4O3 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 3-[5-[[(3S,4R)-3-amino-4-[difluoro(phenyl)methyl]pyrrolidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | N[C@@H]1CN(Cc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)C[C@H]1C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C25H26F2N4O3/c26-25(27,17-4-2-1-3-5-17)19-13-30(14-20(19)28)11-15-6-7-16-12-31(24(34)18(16)10-15)21-8-9-22(32)29-23(21)33/h1-7,10,19-21H,8-9,11-14,28H2,(H,29,32,33)/t19-,20-,21?/m1/s1 |
| InChIKey | UXLACTKVNCWNMR-OSBQEZSISA-N |
| XLogP | 2.00 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|