About (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid
(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid (PubChem CID 167718558) has the molecular formula C9H12BNO3
and a molecular weight of 193.01 g/mol. Its IUPAC name is (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid.
Molecular Properties
| Compound Name | (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid |
| PubChem CID | 167718558 |
| Molecular Formula | C9H12BNO3 |
| Molecular Weight | 193.01 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid |
| SMILES | CC1CNc2cc(B(O)O)ccc2O1 |
| InChI | InChI=1S/C9H12BNO3/c1-6-5-11-8-4-7(10(12)13)2-3-9(8)14-6/h2-4,6,11-13H,5H2,1H3 |
| InChIKey | NJNUJIHQRJCCOB-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.01 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid?
The IUPAC name of (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid (CID 167718558) is (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid.
What is the SMILES notation for (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid?
The canonical SMILES for (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid is CC1CNc2cc(B(O)O)ccc2O1.
What is the InChIKey of (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid?
The InChIKey is NJNUJIHQRJCCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BNO3/c1-6-5-11-8-4-7(10(12)13)2-3-9(8)14-6/h2-4,6,11-13H,5H2,1H3.
What are the key properties of (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid?
(2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid has a molecular weight of 193.01 g/mol, XLogP of -0.44, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-yl)boronic acid is sourced from PubChem (CID 167718558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).