C12H17NO4 — CID 167719193
3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.0]hept-6-ene-2-carboxylic acid (PubChem CID 167719193) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.0]hept-6-ene-2-carboxylic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.0]hept-6-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 167719193 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.0]hept-6-ene-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC2C=CC2C1C(=O)O |
| InChI | InChI=1S/C12H17NO4/c1-12(2,3)17-11(16)13-6-7-4-5-8(7)9(13)10(14)15/h4-5,7-9H,6H2,1-3H3,(H,14,15) |
| InChIKey | JGGRELDRGFJQQY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|