C22H24N6O4 — CID 167719887
4-[[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167719887) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 4-[[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167719887 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-[[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Cn1nccc1[C@@H]1CN(Cc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)C[C@H]1N |
| InChI | InChI=1S/C22H24N6O4/c1-26-16(7-8-24-26)14-10-27(11-15(14)23)9-12-3-2-4-13-19(12)22(32)28(21(13)31)17-5-6-18(29)25-20(17)30/h2-4,7-8,14-15,17H,5-6,9-11,23H2,1H3,(H,25,29,30)/t14-,15-,17?/m1/s1 |
| InChIKey | RADSSECZJSOELD-BLBXNVQISA-N |
| XLogP | -0.25 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|